Products 939986-51-3
CAS 939986-51-3 is the registry number for 1-((2-Chlorothiazol-5-Yl)Methyl)Piperidin-3-Ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-3-ol (CAS 939986-51-3) is a chemical compound with the molecular formula C9H13ClN2OS and a molecular weight of 232.73 g/mol. IUPAC name: 1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-3-ol. InChIKey: WMVYMNKGHLAHQK-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2OS |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-3-ol |
| InChIKey | WMVYMNKGHLAHQK-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CN=C(S2)Cl)O |
Computed by PubChem (NCBI)