Products 940290-58-4
CAS 940290-58-4 appears in our catalog under these names: UK122, UK122 (TFA), 99.85%, UK122, 95.16%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100 mg, 10 mg, 50 mg, 25 mg.
4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzenecarboximidamide (CAS 940290-58-4) is a chemical compound with the molecular formula C17H13N3O2 and a molecular weight of 291.30 g/mol. IUPAC name: 4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzenecarboximidamide. InChIKey: JBHISGPWLXASFE-GXDHUFHOSA-N.
| Molecular formula | C17H13N3O2 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzenecarboximidamide |
| InChIKey | JBHISGPWLXASFE-GXDHUFHOSA-N |
| SMILES | C1=CC=C(C=C1)C2=N/C(=C/C3=CC=C(C=C3)C(=N)N)/C(=O)O2 |
Computed by PubChem (NCBI)