CAS 94102-66-6 appears in our catalog under these names: Pyr-4MbetaNA, Pyr–4MβNA, Pyr-4MbNA. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 0,5g.
(2S)-N-(4-methoxynaphthalen-2-yl)-5-oxopyrrolidine-2-carboxamide (CAS 94102-66-6) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: (2S)-N-(4-methoxynaphthalen-2-yl)-5-oxopyrrolidine-2-carboxamide. InChIKey: KUOSNZTWNCPQEW-ZDUSSCGKSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (2S)-N-(4-methoxynaphthalen-2-yl)-5-oxopyrrolidine-2-carboxamide |
| InChIKey | KUOSNZTWNCPQEW-ZDUSSCGKSA-N |
| SMILES | COC1=CC(=CC2=CC=CC=C21)NC(=O)[C@@H]3CCC(=O)N3 |
Computed by PubChem (NCBI)