Products 94111-79-2

CAS 94111-79-2 is the registry number for Methyl 6-(carboxy)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 6-carbonochloridoylpyridine-2-carboxylate (CAS 94111-79-2) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: methyl 6-carbonochloridoylpyridine-2-carboxylate. InChIKey: RUXIOPUJSQHZPA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO3
Molecular weight199.59 g/mol
IUPAC namemethyl 6-carbonochloridoylpyridine-2-carboxylate
InChIKeyRUXIOPUJSQHZPA-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=CC=C1)C(=O)Cl

Computed by PubChem (NCBI)