CAS 94111-79-2 is the registry number for Methyl 6-(carboxy)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 6-carbonochloridoylpyridine-2-carboxylate (CAS 94111-79-2) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: methyl 6-carbonochloridoylpyridine-2-carboxylate. InChIKey: RUXIOPUJSQHZPA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | methyl 6-carbonochloridoylpyridine-2-carboxylate |
| InChIKey | RUXIOPUJSQHZPA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CC=C1)C(=O)Cl |
Computed by PubChem (NCBI)