CAS 941294-58-2 appears in our catalog under these names: tert-Butyl 6-bromonicotinate, 98%, tert–Butyl 6–bromonicotinate, tert-Butyl 6-bromonicotinate 98%, tert-Butyl 6-bromonicotinate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
Tert-butyl 6-bromopyridine-3-carboxylate (CAS 941294-58-2) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: tert-butyl 6-bromopyridine-3-carboxylate. InChIKey: RTRMFSKLFAYIDW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | tert-butyl 6-bromopyridine-3-carboxylate |
| InChIKey | RTRMFSKLFAYIDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)