CAS 941320-77-0 appears in our catalog under these names: Methyl 2-methyl-6-phenylbenzoate, 95%, Methyl 3-methyl-(1,1'-biphenyl)-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl 2-methyl-6-phenylbenzoate (CAS 941320-77-0) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: methyl 2-methyl-6-phenylbenzoate. InChIKey: CBFUCKQHENSVAN-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | methyl 2-methyl-6-phenylbenzoate |
| InChIKey | CBFUCKQHENSVAN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)