CAS 942195-83-7 appears in our catalog under these names: Tegoprazan Impurity 18, 4–(Benzyloxy)–2–methyl–1H–benzo(d)imidazole–6–carboxylic acid, 4-(Benzyloxy)-2-methyl-1H-benzo[d]imidazole-6-carboxylic acid 95%, 4-(Benzyloxy)-2-methyl-1H-benzo[d]imidazole-6-carboxylic acid, 95%, 95%, 4-(BENZYLOXY)-2-METHYL-1H-BENZO[D]IMIDAZOLE-6-CARBOXYLIC ACID, 98%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
2-methyl-7-phenylmethoxy-3H-benzimidazole-5-carboxylic acid (CAS 942195-83-7) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 2-methyl-7-phenylmethoxy-3H-benzimidazole-5-carboxylic acid. InChIKey: ALVXSXAHKPXTSN-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 2-methyl-7-phenylmethoxy-3H-benzimidazole-5-carboxylic acid |
| InChIKey | ALVXSXAHKPXTSN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)