CAS 942317-54-6 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)-3-(1-methyl-1H-pyrazol-4-yl)propanoic acid, 97%, 2-tert-Butoxycarbonylamino-3-(1-methyl-1H-pyrazol-4-yl)propionic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 50mg, 0,5g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-methylpyrazol-4-yl)propanoic acid (CAS 942317-54-6) is a chemical compound with the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-methylpyrazol-4-yl)propanoic acid. InChIKey: GAZFWAVSPPBWFO-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O4 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-methylpyrazol-4-yl)propanoic acid |
| InChIKey | GAZFWAVSPPBWFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CN(N=C1)C)C(=O)O |
Computed by PubChem (NCBI)