Products 942473-99-6
CAS 942473-99-6 is the registry number for 2-Amino-4-bromo-7-methylbenzothiazole, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-7-methyl-1,3-benzothiazol-2-amine (CAS 942473-99-6) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 4-bromo-7-methyl-1,3-benzothiazol-2-amine. InChIKey: PYZZROCLYVMLNB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 4-bromo-7-methyl-1,3-benzothiazol-2-amine |
| InChIKey | PYZZROCLYVMLNB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)N=C(S2)N |
Computed by PubChem (NCBI)