CAS 943739-90-0 is the registry number for Perampanel Impurity 40. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-(4-boronophenyl)butanoic acid (CAS 943739-90-0) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: 4-(4-boronophenyl)butanoic acid. InChIKey: GKUYDOVOSQZMKF-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | 4-(4-boronophenyl)butanoic acid |
| InChIKey | GKUYDOVOSQZMKF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCCC(=O)O)(O)O |
Computed by PubChem (NCBI)