Products 943845-86-1
CAS 943845-86-1 appears in our catalog under these names: Methyl 4–(aminomethyl)cubane–1–carboxylate hydrochloride, Methyl 4-(aminomethyl)cubane-1-carboxylate hydrochloride, 97%, 97%, Methyl 4-(aminomethyl)cubane-1-carboxylate hydrochloride, 97%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
Methyl 4-(aminomethyl)cubane-1-carboxylate;hydrochloride (CAS 943845-86-1) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 4-(aminomethyl)cubane-1-carboxylate;hydrochloride. InChIKey: IWSPFEZFPWFMTF-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 4-(aminomethyl)cubane-1-carboxylate;hydrochloride |
| InChIKey | IWSPFEZFPWFMTF-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45CN.Cl |
Computed by PubChem (NCBI)