CAS 944058-99-5 appears in our catalog under these names: 4,6-Dichloro-2-(methanesulfonylmethyl)pyrimidine, 98%, 4,6-Dichloro-2-(methanesulfonylmethyl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 50mg, 0,5g.
4,6-dichloro-2-(methylsulfonylmethyl)pyrimidine (CAS 944058-99-5) is a chemical compound with the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.09 g/mol. IUPAC name: 4,6-dichloro-2-(methylsulfonylmethyl)pyrimidine. InChIKey: XILOXVPSHDYAFO-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 4,6-dichloro-2-(methylsulfonylmethyl)pyrimidine |
| InChIKey | XILOXVPSHDYAFO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=NC(=CC(=N1)Cl)Cl |
Computed by PubChem (NCBI)