CAS 944263-08-5 appears in our catalog under these names: Demiditraz Impurity 1, rac-Demiditraz. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,005g, 0,002g, 0,01g, 0,025g.
2-[1-(2,3-dimethylphenyl)ethyl]-1H-imidazole (CAS 944263-08-5) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 2-[1-(2,3-dimethylphenyl)ethyl]-1H-imidazole. InChIKey: FXJRDUKXWHFPND-UHFFFAOYSA-N.
| Molecular formula | C13H16N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 2-[1-(2,3-dimethylphenyl)ethyl]-1H-imidazole |
| InChIKey | FXJRDUKXWHFPND-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=NC=CN2)C |
Computed by PubChem (NCBI)