CAS 944263-65-4 appears in our catalog under these names: (S)-2-(1-(2,3-Dimethylphenyl)ethyl)-1H-imidazole, 95+%, Demiditraz, 2-(1-(2,3-Dimethylphenyl)ethyl)-1H-imidazole. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 2g.
2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole (CAS 944263-65-4) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole. InChIKey: FXJRDUKXWHFPND-NSHDSACASA-N.
| Molecular formula | C13H16N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole |
| InChIKey | FXJRDUKXWHFPND-NSHDSACASA-N |
| SMILES | CC1=C(C(=CC=C1)[C@H](C)C2=NC=CN2)C |
Computed by PubChem (NCBI)