Products 944386-94-1
CAS 944386-94-1 is the registry number for 2,2'-Dimethyl-[1,1'-binaphthalene]-8,8'-diamine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
8-(8-amino-2-methylnaphthalen-1-yl)-7-methylnaphthalen-1-amine (CAS 944386-94-1) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: 8-(8-amino-2-methylnaphthalen-1-yl)-7-methylnaphthalen-1-amine. InChIKey: JIDWQVXCUPXYJN-UHFFFAOYSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 8-(8-amino-2-methylnaphthalen-1-yl)-7-methylnaphthalen-1-amine |
| InChIKey | JIDWQVXCUPXYJN-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC=C2N)C=C1)C3=C(C=CC4=C3C(=CC=C4)N)C |
Computed by PubChem (NCBI)