Products 94451-48-6
CAS 94451-48-6 appears in our catalog under these names: Syzalterin, Syzalterin, 99.05%, Syzalterin, 96.0%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 0,5mg, 1mg, 1 mg.
5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one (CAS 94451-48-6) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one. InChIKey: VDYGMHWAKRDYQR-UHFFFAOYSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one |
| InChIKey | VDYGMHWAKRDYQR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC=C(C=C3)O)C)O |
Computed by PubChem (NCBI)