Products 944901-49-9
CAS 944901-49-9 is the registry number for 1-(3-Methoxyphenyl)-1h-1,2,3-triazole-4-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3-methoxyphenyl)triazole-4-carbaldehyde (CAS 944901-49-9) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-(3-methoxyphenyl)triazole-4-carbaldehyde. InChIKey: AADSLEFBRAGBPS-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)triazole-4-carbaldehyde |
| InChIKey | AADSLEFBRAGBPS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2C=C(N=N2)C=O |
Computed by PubChem (NCBI)