CAS 944904-11-4 is the registry number for 7-Bromochroman-3-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromo-4H-chromen-3-one (CAS 944904-11-4) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 7-bromo-4H-chromen-3-one. InChIKey: HYTUXLBZBRFDRR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 7-bromo-4H-chromen-3-one |
| InChIKey | HYTUXLBZBRFDRR-UHFFFAOYSA-N |
| SMILES | C1C(=O)COC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)