Products 94529-97-2
CAS 94529-97-2 appears in our catalog under these names: 20-Deoxocarnosol, min. 95 %, 2 mg, 20–Deoxocarnosol, 20-Deoxocarnosol, 20-Deoxocarnosol, 98.0%, 98.0%, 20-Deoxocarnosol, 98.0%. Offered by: Roth, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg, 1 mg.
(1R,8S,10S)-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-triene-3,4-diol (CAS 94529-97-2) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: (1R,8S,10S)-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-triene-3,4-diol. InChIKey: XCVWKCGUFCXDHN-AUSJPIAWSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (1R,8S,10S)-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-triene-3,4-diol |
| InChIKey | XCVWKCGUFCXDHN-AUSJPIAWSA-N |
| SMILES | CC(C)C1=C(C(=C2C(=C1)[C@@H]3C[C@@H]4[C@@]2(CCCC4(C)C)CO3)O)O |
Computed by PubChem (NCBI)
Synonyms:
20-deoxocarnosol, orb1683733