Products 94559-28-1
CAS 94559-28-1 is the registry number for 3-(3-(Trifluoromethyl)phenyl)pyrrolidin-2-one, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
3-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one (CAS 94559-28-1) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one. InChIKey: DJGFNQQJFQRHLJ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| InChIKey | DJGFNQQJFQRHLJ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C1C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)