CAS 94596-97-1 appears in our catalog under these names: 2-Methoxy-6-pivalamidobenzoic acid, 97%, 2-Methoxy-6-pivalamidobenzoic acid, 95%, 2-(2,2-Dimethylpropanamido)-6-methoxybenzoic acid. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 50mg, 0,5g.
2-(2,2-dimethylpropanoylamino)-6-methoxybenzoic acid (CAS 94596-97-1) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-6-methoxybenzoic acid. InChIKey: IZAPLQNXKLDGAW-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-6-methoxybenzoic acid |
| InChIKey | IZAPLQNXKLDGAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C(=CC=C1)OC)C(=O)O |
Computed by PubChem (NCBI)