CAS 946387-37-7 is the registry number for 2-chloro-3-((4-ethoxyphenyl)amino)-5-methylcyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
2-chloro-3-(4-ethoxyanilino)-5-methylcyclohex-2-en-1-one (CAS 946387-37-7) is a chemical compound with the molecular formula C15H18ClNO2 and a molecular weight of 279.76 g/mol. IUPAC name: 2-chloro-3-(4-ethoxyanilino)-5-methylcyclohex-2-en-1-one. InChIKey: HGNFTFDTZORBBW-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO2 |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | 2-chloro-3-(4-ethoxyanilino)-5-methylcyclohex-2-en-1-one |
| InChIKey | HGNFTFDTZORBBW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=C(C(=O)CC(C2)C)Cl |
Computed by PubChem (NCBI)