Products 94645-36-0
CAS 94645-36-0 is the registry number for 10-oxopentacyclo(5.3.0.02,5.03,9.04,8)decane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
10-oxopentacyclo[5.3.0.02,5.03,9.04,8]decane-3-carboxylic acid (CAS 94645-36-0) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 10-oxopentacyclo[5.3.0.02,5.03,9.04,8]decane-3-carboxylic acid. InChIKey: KBMWEJWOWMZMMD-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 10-oxopentacyclo[5.3.0.02,5.03,9.04,8]decane-3-carboxylic acid |
| InChIKey | KBMWEJWOWMZMMD-UHFFFAOYSA-N |
| SMILES | C1C2C3C4C1C5C2C(=O)C3C45C(=O)O |
Computed by PubChem (NCBI)