Products 946525-65-1
CAS 946525-65-1 appears in our catalog under these names: Velagliflozin, Velagliflozin, 99.92%, Velagliflozin, 98%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 0,5mg, 2mg, 5mg, 50 mg, 25 mg, 100 mg, 10 mg.
2-[(4-cyclopropylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile (CAS 946525-65-1) is a chemical compound with the molecular formula C23H25NO5 and a molecular weight of 395.4 g/mol. IUPAC name: 2-[(4-cyclopropylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile. InChIKey: SENUNDCNOYAWGN-ZQGJOIPISA-N.
| Molecular formula | C23H25NO5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 2-[(4-cyclopropylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
| InChIKey | SENUNDCNOYAWGN-ZQGJOIPISA-N |
| SMILES | C1CC1C2=CC=C(C=C2)CC3=C(C=CC(=C3)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C#N |
Computed by PubChem (NCBI)