CAS 946714-21-2 is the registry number for 3-(2,3-Dichlorophenoxy)piperidine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2,3-dichlorophenoxy)piperidine (CAS 946714-21-2) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: 3-(2,3-dichlorophenoxy)piperidine. InChIKey: MZYHMWFKZMEGRK-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 3-(2,3-dichlorophenoxy)piperidine |
| InChIKey | MZYHMWFKZMEGRK-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)OC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)