Products 947279-29-0
CAS 947279-29-0 appears in our catalog under these names: 4-(benzyloxy)-2,3-difluorobenzaldehyde, 95%, 2,3-Difluoro-4-(phenoxymethyl)benzaldehyde, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
2,3-difluoro-4-(phenoxymethyl)benzaldehyde (CAS 947279-29-0) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2,3-difluoro-4-(phenoxymethyl)benzaldehyde. InChIKey: JLOGGNUJFKUZBX-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 2,3-difluoro-4-(phenoxymethyl)benzaldehyde |
| InChIKey | JLOGGNUJFKUZBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=C(C(=C(C=C2)C=O)F)F |
Computed by PubChem (NCBI)