CAS 94733-89-8 appears in our catalog under these names: 2-(1,3-Dioxoisoindolin-2-yl)-3-mercaptopropanoic acid, 98%, 2–(1，3–DIOXO–2，3–DIHYDRO–1H–ISOINDOL–2–YL)–3–SULFANYLPROPANOIC ACID, 2-(1,3-Dioxoisoindolin-2-yl)-3-mercaptopropanoic acid, 95%, 95%, 2-(1,3-DIOXO-2,3-DIHYDRO-1H-ISOINDOL-2-YL)-3-SULFANYLPROPANOIC ACID, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg.
2-(1,3-dioxoisoindol-2-yl)-3-sulfanylpropanoic acid (CAS 94733-89-8) is a chemical compound with the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-sulfanylpropanoic acid. InChIKey: KHYKDXCOERMWAJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-3-sulfanylpropanoic acid |
| InChIKey | KHYKDXCOERMWAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C(CS)C(=O)O |
Computed by PubChem (NCBI)