Products 947592-43-0
CAS 947592-43-0 is the registry number for 5-(3-Chlorophenyl)-2-pyrimidinamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
5-(3-chlorophenyl)pyrimidin-2-amine (CAS 947592-43-0) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 5-(3-chlorophenyl)pyrimidin-2-amine. InChIKey: IOTJSRLGIUWITD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 5-(3-chlorophenyl)pyrimidin-2-amine |
| InChIKey | IOTJSRLGIUWITD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CN=C(N=C2)N |
Computed by PubChem (NCBI)