CAS 948051-11-4 is the registry number for Ferulic Acid Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3-ethoxy-4-hydroxyphenyl)prop-2-enoic acid (CAS 948051-11-4) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (E)-3-(3-ethoxy-4-hydroxyphenyl)prop-2-enoic acid. InChIKey: ZWHTWBSYWXSZCD-GQCTYLIASA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (E)-3-(3-ethoxy-4-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | ZWHTWBSYWXSZCD-GQCTYLIASA-N |
| SMILES | CCOC1=C(C=CC(=C1)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)