CAS 948289-20-1 is the registry number for 6-Chloro-2,8-dimethylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-chloro-2,8-dimethylquinoline (CAS 948289-20-1) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 6-chloro-2,8-dimethylquinoline. InChIKey: MVXUKVOJHFTFPP-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 6-chloro-2,8-dimethylquinoline |
| InChIKey | MVXUKVOJHFTFPP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C=C2C)Cl |
Computed by PubChem (NCBI)