CAS 948293-29-6 is the registry number for 7,8-Dimethyl-4-quinolinamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
7,8-dimethylquinolin-4-amine (CAS 948293-29-6) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 7,8-dimethylquinolin-4-amine. InChIKey: BWRQKOAAHRMZIV-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 7,8-dimethylquinolin-4-amine |
| InChIKey | BWRQKOAAHRMZIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC=CC(=C2C=C1)N)C |
Computed by PubChem (NCBI)