CAS 949139-74-6 appears in our catalog under these names: 1-Bromo-6,7-dimethoxyisoquinoline, 95+%, 1-Bromo-6,7-dimethoxyisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-bromo-6,7-dimethoxyisoquinoline (CAS 949139-74-6) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 1-bromo-6,7-dimethoxyisoquinoline. InChIKey: XJERWSWRQPHTIK-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 1-bromo-6,7-dimethoxyisoquinoline |
| InChIKey | XJERWSWRQPHTIK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN=C2Br)OC |
Computed by PubChem (NCBI)