CAS 950785-37-2 appears in our catalog under these names: 2-(4-Bromobenzyl)isothiazolidine 1,1-dioxide, 97%, 2-((4-Bromophenyl)methyl)-1,2-thiazolidine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[(4-bromophenyl)methyl]-1,2-thiazolidine 1,1-dioxide (CAS 950785-37-2) is a chemical compound with the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]-1,2-thiazolidine 1,1-dioxide. InChIKey: TYLGBYPNRCBPLB-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]-1,2-thiazolidine 1,1-dioxide |
| InChIKey | TYLGBYPNRCBPLB-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)