Products 951806-14-7
CAS 951806-14-7 appears in our catalog under these names: 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)aniline, 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)aniline, 95%, 4-[5-(TRIFLUOROMETHYL)-1,2,4-OXADIAZOL-3-YL]ANILINE, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 100mg.
4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline (CAS 951806-14-7) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline. InChIKey: PXUUTRRMFPULDM-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline |
| InChIKey | PXUUTRRMFPULDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(F)(F)F)N |
Computed by PubChem (NCBI)