Products 95188-34-4
CAS 95188-34-4 is the registry number for Sibiricin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, Get quote.
8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-5,7-dimethoxychromen-2-one (CAS 95188-34-4) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: 8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-5,7-dimethoxychromen-2-one. InChIKey: UOEQXGRDVIMHFZ-ZDUSSCGKSA-N.
| Molecular formula | C16H18O5 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-5,7-dimethoxychromen-2-one |
| InChIKey | UOEQXGRDVIMHFZ-ZDUSSCGKSA-N |
| SMILES | CC1([C@@H](O1)CC2=C(C=C(C3=C2OC(=O)C=C3)OC)OC)C |
Computed by PubChem (NCBI)