CAS 95192-65-7 is the registry number for 1-Methoxy-2-methyl-3,5-dinitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-methoxy-2-methyl-3,5-dinitrobenzene (CAS 95192-65-7) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: 1-methoxy-2-methyl-3,5-dinitrobenzene. InChIKey: OXQUVCBSDOTICH-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | 1-methoxy-2-methyl-3,5-dinitrobenzene |
| InChIKey | OXQUVCBSDOTICH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1OC)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)