CAS 952059-61-9 is the registry number for 4-Chloro-6-methoxy-1,7-naphthyridine, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
4-chloro-6-methoxy-1,7-naphthyridine (CAS 952059-61-9) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 4-chloro-6-methoxy-1,7-naphthyridine. InChIKey: GNZAJNWAVRMJSU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 4-chloro-6-methoxy-1,7-naphthyridine |
| InChIKey | GNZAJNWAVRMJSU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=N1)Cl |
Computed by PubChem (NCBI)