CAS 952138-19-1 appears in our catalog under these names: 4-Chloro-7-methoxy-1,6-naphthyridine, 97%, 4-Chloro-7-methoxy-1,6-naphthyridine, 95+%, 4-Chloro-7-Methoxy-1,6-naphthyridine, 97.0%, 97.0%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
4-chloro-7-methoxy-1,6-naphthyridine (CAS 952138-19-1) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 4-chloro-7-methoxy-1,6-naphthyridine. InChIKey: JOXFTPKSSCWINI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 4-chloro-7-methoxy-1,6-naphthyridine |
| InChIKey | JOXFTPKSSCWINI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=N1)Cl |
Computed by PubChem (NCBI)