CAS 952289-92-8 appears in our catalog under these names: 1–(4–Bromophenyl)cyclopropanamine hydrochloride, 1-(4-bromophenyl)cyclopropan-1-amine hydrochloride, 1-(4-Bromophenyl)cyclopropan-1-amine hydrochloride, 95%, 95%, 1-(4-Bromophenyl)cyclopropan-1-amine hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g.
1-(4-bromophenyl)cyclopropan-1-amine;hydrochloride (CAS 952289-92-8) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 1-(4-bromophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: FFXYZHNZHKTMOS-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | FFXYZHNZHKTMOS-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)