CAS 952664-86-7 is the registry number for 2-Cyclopropyl-1h-indol-5-amine, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
2-cyclopropyl-1H-indol-5-amine (CAS 952664-86-7) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 2-cyclopropyl-1H-indol-5-amine. InChIKey: HAWGARJMIORRKH-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 2-cyclopropyl-1H-indol-5-amine |
| InChIKey | HAWGARJMIORRKH-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC3=C(N2)C=CC(=C3)N |
Computed by PubChem (NCBI)