Products 952958-71-3
CAS 952958-71-3 appears in our catalog under these names: 4-Acetamido-3,5-dimethylbenzene-1-sulfonyl chloride, ≥95%, ≥95%, 4-Acetamido-3,5-dimethylbenzenesulfonyl chloride, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g.
4-acetamido-3,5-dimethylbenzenesulfonyl chloride (CAS 952958-71-3) is a chemical compound with the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. IUPAC name: 4-acetamido-3,5-dimethylbenzenesulfonyl chloride. InChIKey: FEHZPHPLDGHTPM-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3S |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 4-acetamido-3,5-dimethylbenzenesulfonyl chloride |
| InChIKey | FEHZPHPLDGHTPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)