CAS 95306-94-8 appears in our catalog under these names: 4-Formyl-2,6-dimethylphenyl acetate, 95%, 4-Formyl-2,6-dimethylphenyl acetate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-formyl-2,6-dimethylphenyl) acetate (CAS 95306-94-8) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (4-formyl-2,6-dimethylphenyl) acetate. InChIKey: TVTIBBMRARODJH-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (4-formyl-2,6-dimethylphenyl) acetate |
| InChIKey | TVTIBBMRARODJH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC(=O)C)C)C=O |
Computed by PubChem (NCBI)