CAS 953731-77-6 is the registry number for 6-(2,4-Dimethylphenyl)-3-methyl-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2,4-dimethylphenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 953731-77-6) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 6-(2,4-dimethylphenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: PMDKKOGRWREGQK-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 6-(2,4-dimethylphenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | PMDKKOGRWREGQK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NC3=C(C(=NO3)C)C(=C2)C(=O)O)C |
Computed by PubChem (NCBI)