CAS 95383-36-1 is the registry number for 2-Bromo-4-fluorobenzoylchloride 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-bromo-4-fluorobenzoyl chloride (CAS 95383-36-1) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-4-fluorobenzoyl chloride. InChIKey: AXZRUTPBQMAWLP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 2-bromo-4-fluorobenzoyl chloride |
| InChIKey | AXZRUTPBQMAWLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)C(=O)Cl |
Computed by PubChem (NCBI)