Products 954227-12-4
CAS 954227-12-4 is the registry number for Ethyl 2-m-tolylpyrimidine-5-carboxylate, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
Ethyl 2-(3-methylphenyl)pyrimidine-5-carboxylate (CAS 954227-12-4) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: ethyl 2-(3-methylphenyl)pyrimidine-5-carboxylate. InChIKey: JNPNGYQLLZTRIT-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | ethyl 2-(3-methylphenyl)pyrimidine-5-carboxylate |
| InChIKey | JNPNGYQLLZTRIT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)