Products 954254-92-3
CAS 954254-92-3 appears in our catalog under these names: 2-(2-Amino-5-chlorophenyl)-octahydro-1H-isoindole-1,3-dione, 95%, 2-(2-Amino-5-chlorophenyl)-octahydro-1H-isoindole-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(2-amino-5-chlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (CAS 954254-92-3) is a chemical compound with the molecular formula C14H15ClN2O2 and a molecular weight of 278.73 g/mol. IUPAC name: 2-(2-amino-5-chlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione. InChIKey: KDLGEEURYFHQDJ-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2 |
|---|---|
| Molecular weight | 278.73 g/mol |
| IUPAC name | 2-(2-amino-5-chlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| InChIKey | KDLGEEURYFHQDJ-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C(=O)N(C2=O)C3=C(C=CC(=C3)Cl)N |
Computed by PubChem (NCBI)