CAS 954571-06-3 is the registry number for 8-Chloro-6-fluoro-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
8-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline (CAS 954571-06-3) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: 8-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline. InChIKey: DRALUZCRYBRUGV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | 8-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline |
| InChIKey | DRALUZCRYBRUGV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)F)Cl)NC1 |
Computed by PubChem (NCBI)