CAS 95486-32-1 is the registry number for Monoisovalerate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(9R,10R)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 3-methylbutanoate (CAS 95486-32-1) is a chemical compound with the molecular formula C19H22O6 and a molecular weight of 346.4 g/mol. IUPAC name: [(9R,10R)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 3-methylbutanoate. InChIKey: IQVBHJMBBBNYAR-QZTJIDSGSA-N.
| Molecular formula | C19H22O6 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | [(9R,10R)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 3-methylbutanoate |
| InChIKey | IQVBHJMBBBNYAR-QZTJIDSGSA-N |
| SMILES | CC(C)CC(=O)O[C@H]1[C@H](C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)O |
Computed by PubChem (NCBI)