CAS 956181-55-8 appears in our catalog under these names: 1-Phenyl-3-(4-(propan-2-yl)phenyl)-1H-pyrazole-4-carboxylic acid, 95%, 1-Phenyl-3-(4-(propan-2-yl)phenyl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-phenyl-3-(4-propan-2-ylphenyl)pyrazole-4-carboxylic acid (CAS 956181-55-8) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: 1-phenyl-3-(4-propan-2-ylphenyl)pyrazole-4-carboxylic acid. InChIKey: OEAMTQVYPYFSGQ-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1-phenyl-3-(4-propan-2-ylphenyl)pyrazole-4-carboxylic acid |
| InChIKey | OEAMTQVYPYFSGQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)