Products 956296-81-4

CAS 956296-81-4 is the registry number for 2-(4-Methoxyphenyl)-4H-furo(3,2-b)pyrrole-5-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

2-(4-methoxyphenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CAS 956296-81-4) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 2-(4-methoxyphenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid. InChIKey: YJDOOZAXSYRWPY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11NO4
Molecular weight257.24 g/mol
IUPAC name2-(4-methoxyphenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid
InChIKeyYJDOOZAXSYRWPY-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=CC3=C(O2)C=C(N3)C(=O)O

Computed by PubChem (NCBI)